C23H21NO10 — CID 140505779
methyl (E)-3-[(5aR,6S,6aR,10aR)-9-carbamoyl-1,6,10,10a,12-pentahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]prop-2-enoate (PubChem CID 140505779) has the molecular formula C23H21NO10 and a molecular weight of 471.42 g/mol. Its IUPAC name is methyl (E)-3-[(5aR,6S,6aR,10aR)-9-carbamoyl-1,6,10,10a,12-pentahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(5aR,6S,6aR,10aR)-9-carbamoyl-1,6,10,10a,12-pentahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 140505779 |
| Molecular Formula | C23H21NO10 |
| Molecular Weight | 471.42 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | methyl (E)-3-[(5aR,6S,6aR,10aR)-9-carbamoyl-1,6,10,10a,12-pentahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C[C@@H]3[C@@H](O)[C@@H]1C2 |
| InChI | InChI=1S/C23H21NO10/c1-34-13(26)5-4-8-2-3-9-6-10-15(19(29)14(9)17(8)27)20(30)23(33)11(18(10)28)7-12(25)16(21(23)31)22(24)32/h2-5,10-11,18,27-29,31,33H,6-7H2,1H3,(H2,24,32)/b5-4+/t10-,11-,18+,23+/m1/s1 |
| InChIKey | VAWFDVSVFNWZFW-KSZLQQFESA-N |
| XLogP | -0.42 |
| TPSA | 204.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.42 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|