C28H29NO10 — CID 58648226
butyl (E)-3-[(6aR,10aR,11S,11aS,12R)-8-carbamoyl-11-formyl-4,5,6a,7-tetrahydroxy-12-methyl-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]prop-2-enoate (PubChem CID 58648226) has the molecular formula C28H29NO10 and a molecular weight of 539.54 g/mol. Its IUPAC name is butyl (E)-3-[(6aR,10aR,11S,11aS,12R)-8-carbamoyl-11-formyl-4,5,6a,7-tetrahydroxy-12-methyl-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]prop-2-enoate.
| Compound Name | butyl (E)-3-[(6aR,10aR,11S,11aS,12R)-8-carbamoyl-11-formyl-4,5,6a,7-tetrahydroxy-12-methyl-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 58648226 |
| Molecular Formula | C28H29NO10 |
| Molecular Weight | 539.54 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | butyl (E)-3-[(6aR,10aR,11S,11aS,12R)-8-carbamoyl-11-formyl-4,5,6a,7-tetrahydroxy-12-methyl-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]prop-2-enoate |
| SMILES | CCCCOC(=O)/C=C/c1ccc(O)c2c1[C@H](C)[C@@H]1C(=C2O)C(=O)[C@]2(O)C(O)=C(C(N)=O)C(=O)C[C@@H]2[C@H]1C=O |
| InChI | InChI=1S/C28H29NO10/c1-3-4-9-39-18(33)8-6-13-5-7-16(31)21-19(13)12(2)20-14(11-30)15-10-17(32)22(27(29)37)25(35)28(15,38)26(36)23(20)24(21)34/h5-8,11-12,14-15,20,31,34-35,38H,3-4,9-10H2,1-2H3,(H2,29,37)/b8-6+/t12-,14+,15+,20-,28+/m0/s1 |
| InChIKey | YKUYQUPKHHUBPL-PXEWBAGNSA-N |
| XLogP | 1.77 |
| TPSA | 201.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.54 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|