C24H23NO10 — CID 54723038
methyl (E)-3-(9-carbamoyl-1,6,10,10a,12-pentahydroxy-5-methyl-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl)prop-2-enoate (PubChem CID 54723038) has the molecular formula C24H23NO10 and a molecular weight of 485.45 g/mol. Its IUPAC name is methyl (E)-3-(9-carbamoyl-1,6,10,10a,12-pentahydroxy-5-methyl-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl)prop-2-enoate.
| Compound Name | methyl (E)-3-(9-carbamoyl-1,6,10,10a,12-pentahydroxy-5-methyl-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 54723038 |
| Molecular Formula | C24H23NO10 |
| Molecular Weight | 485.45 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | methyl (E)-3-(9-carbamoyl-1,6,10,10a,12-pentahydroxy-5-methyl-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl)prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc2c(c1O)C(O)=C1C(=O)C3(O)C(O)=C(C(N)=O)C(=O)CC3C(O)C1C2C |
| InChI | InChI=1S/C24H23NO10/c1-8-10-5-3-9(4-6-13(27)35-2)18(28)15(10)20(30)17-14(8)19(29)11-7-12(26)16(23(25)33)21(31)24(11,34)22(17)32/h3-6,8,11,14,19,28-31,34H,7H2,1-2H3,(H2,25,33)/b6-4+ |
| InChIKey | YAJOLRZNOHKQQQ-GQCTYLIASA-N |
| XLogP | 0.14 |
| TPSA | 204.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.45 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|