C25H26N2O8 — CID 140502824
(4aR,5S,5aS,12aR)-9-amino-5-(2-cyclobutyl-2-oxoethyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 140502824) has the molecular formula C25H26N2O8 and a molecular weight of 482.49 g/mol. Its IUPAC name is (4aR,5S,5aS,12aR)-9-amino-5-(2-cyclobutyl-2-oxoethyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aS,12aR)-9-amino-5-(2-cyclobutyl-2-oxoethyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 140502824 |
| Molecular Formula | C25H26N2O8 |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | (4aR,5S,5aS,12aR)-9-amino-5-(2-cyclobutyl-2-oxoethyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(ccc(N)c4O)C[C@H]3[C@H](CC(=O)C3CCC3)[C@H]2CC1=O |
| InChI | InChI=1S/C25H26N2O8/c26-14-5-4-10-6-12-11(7-15(28)9-2-1-3-9)13-8-16(29)19(24(27)34)23(33)25(13,35)22(32)18(12)21(31)17(10)20(14)30/h4-5,9,11-13,30-31,33,35H,1-3,6-8,26H2,(H2,27,34)/t11-,12-,13+,25-/m0/s1 |
| InChIKey | UAKKZGPURLOIGB-FGFNRVIRSA-N |
| XLogP | 0.99 |
| TPSA | 201.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|