C27H23NO9 — CID 140502825
[(4aR,5S,5aR,12aR)-2-carbamoyl-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] 2-phenylacetate (PubChem CID 140502825) has the molecular formula C27H23NO9 and a molecular weight of 505.48 g/mol. Its IUPAC name is [(4aR,5S,5aR,12aR)-2-carbamoyl-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] 2-phenylacetate.
| Compound Name | [(4aR,5S,5aR,12aR)-2-carbamoyl-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] 2-phenylacetate |
|---|---|
| PubChem CID | 140502825 |
| Molecular Formula | C27H23NO9 |
| Molecular Weight | 505.48 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | [(4aR,5S,5aR,12aR)-2-carbamoyl-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] 2-phenylacetate |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cccc4C[C@H]3[C@H](OC(=O)Cc3ccccc3)[C@H]2CC1=O |
| InChI | InChI=1S/C27H23NO9/c28-26(35)21-17(30)11-15-23(37-18(31)9-12-5-2-1-3-6-12)14-10-13-7-4-8-16(29)19(13)22(32)20(14)24(33)27(15,36)25(21)34/h1-8,14-15,23,29,32,34,36H,9-11H2,(H2,28,35)/t14-,15-,23+,27+/m1/s1 |
| InChIKey | MZXAQHWSGINFBY-LTKQAWPCSA-N |
| XLogP | 1.19 |
| TPSA | 184.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.48 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|