C21H19NO10 — CID 140505781
methyl (6S,10aR)-9-carbamoyl-1,6,10,10a,12-pentahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracene-2-carboxylate (PubChem CID 140505781) has the molecular formula C21H19NO10 and a molecular weight of 445.38 g/mol. Its IUPAC name is methyl (6S,10aR)-9-carbamoyl-1,6,10,10a,12-pentahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracene-2-carboxylate.
| Compound Name | methyl (6S,10aR)-9-carbamoyl-1,6,10,10a,12-pentahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracene-2-carboxylate |
|---|---|
| PubChem CID | 140505781 |
| Molecular Formula | C21H19NO10 |
| Molecular Weight | 445.38 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | methyl (6S,10aR)-9-carbamoyl-1,6,10,10a,12-pentahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracene-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)CC3[C@@H](O)C1C2 |
| InChI | InChI=1S/C21H19NO10/c1-32-20(30)7-3-2-6-4-8-12(16(26)11(6)15(7)25)17(27)21(31)9(14(8)24)5-10(23)13(18(21)28)19(22)29/h2-3,8-9,14,24-26,28,31H,4-5H2,1H3,(H2,22,29)/t8?,9?,14-,21-/m0/s1 |
| InChIKey | RVSVYTRYJWVWPQ-YCTKZLFKSA-N |
| XLogP | -0.82 |
| TPSA | 204.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.38 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|