C29H38N4O9 — CID 118505018
[4-[9-carbamoyl-7-(dimethylamino)-1,6,10,10a,12-pentahydroxy-5-methyl-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-4-methylpentyl] carbamimidate (PubChem CID 118505018) has the molecular formula C29H38N4O9 and a molecular weight of 586.64 g/mol. Its IUPAC name is [4-[9-carbamoyl-7-(dimethylamino)-1,6,10,10a,12-pentahydroxy-5-methyl-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-4-methylpentyl] carbamimidate.
| Compound Name | [4-[9-carbamoyl-7-(dimethylamino)-1,6,10,10a,12-pentahydroxy-5-methyl-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-4-methylpentyl] carbamimidate |
|---|---|
| PubChem CID | 118505018 |
| Molecular Formula | C29H38N4O9 |
| Molecular Weight | 586.64 g/mol |
| Exact Mass | 586.26 |
| IUPAC Name | [4-[9-carbamoyl-7-(dimethylamino)-1,6,10,10a,12-pentahydroxy-5-methyl-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-4-methylpentyl] carbamimidate |
| SMILES | [H]/N=C(\N)OCCCC(C)(C)c1ccc2c(c1O)C(O)=C1C(=O)C3(O)C(O)=C(C(N)=O)C(=O)C(N(C)C)C3C(O)C1C2C |
| InChI | InChI=1S/C29H38N4O9/c1-11-12-7-8-13(28(2,3)9-6-10-42-27(31)32)20(34)15(12)21(35)16-14(11)22(36)18-19(33(4)5)23(37)17(26(30)40)25(39)29(18,41)24(16)38/h7-8,11,14,18-19,22,34-36,39,41H,6,9-10H2,1-5H3,(H2,30,40)(H3,31,32) |
| InChIKey | YWWWMPKHOAQRSR-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 240.72 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.64 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|