C26H31FN2O8 — CID 158956321
(4S,4aR,5S,5aR,6R,12aR)-4-(dimethylamino)-9-(4-fluorobutyl)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 158956321) has the molecular formula C26H31FN2O8 and a molecular weight of 518.54 g/mol. Its IUPAC name is (4S,4aR,5S,5aR,6R,12aR)-4-(dimethylamino)-9-(4-fluorobutyl)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aR,5S,5aR,6R,12aR)-4-(dimethylamino)-9-(4-fluorobutyl)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 158956321 |
| Molecular Formula | C26H31FN2O8 |
| Molecular Weight | 518.54 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | (4S,4aR,5S,5aR,6R,12aR)-4-(dimethylamino)-9-(4-fluorobutyl)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | C[C@H]1c2ccc(CCCCF)c(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C26H31FN2O8/c1-10-12-8-7-11(6-4-5-9-27)19(30)14(12)20(31)15-13(10)21(32)17-18(29(2)3)22(33)16(25(28)36)24(35)26(17,37)23(15)34/h7-8,10,13,17-18,21,30-32,35,37H,4-6,9H2,1-3H3,(H2,28,36)/t10-,13+,17+,18-,21-,26-/m0/s1 |
| InChIKey | RVOVJAJPPWFAPE-PASAGSTDSA-N |
| XLogP | 0.79 |
| TPSA | 181.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.54 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|