C32H35N3O8 — CID 54722354
1,5,10,11,12a-pentahydroxy-6-methyl-9-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54722354) has the molecular formula C32H35N3O8 and a molecular weight of 589.65 g/mol. Its IUPAC name is 1,5,10,11,12a-pentahydroxy-6-methyl-9-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 1,5,10,11,12a-pentahydroxy-6-methyl-9-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54722354 |
| Molecular Formula | C32H35N3O8 |
| Molecular Weight | 589.65 g/mol |
| Exact Mass | 589.24 |
| IUPAC Name | 1,5,10,11,12a-pentahydroxy-6-methyl-9-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC1c2ccc(-c3cccc(CN4CCN(C)CC4)c3)c(O)c2C(O)=C2C(=O)C3(O)C(O)=C(C(N)=O)C(=O)CC3C(O)C21 |
| InChI | InChI=1S/C32H35N3O8/c1-15-18-6-7-19(17-5-3-4-16(12-17)14-35-10-8-34(2)9-11-35)26(37)23(18)28(39)25-22(15)27(38)20-13-21(36)24(31(33)42)29(40)32(20,43)30(25)41/h3-7,12,15,20,22,27,37-40,43H,8-11,13-14H2,1-2H3,(H2,33,42) |
| InChIKey | OGCXVBVUFNDWMZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 184.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.65 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|