C29H34O8 — CID 153105385
(4aR,11R,11aR,12S,12aR)-3-[2-(1-ethylcyclohexyl)acetyl]-4,4a,6,7,12-pentahydroxy-11-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione (PubChem CID 153105385) has the molecular formula C29H34O8 and a molecular weight of 510.58 g/mol. Its IUPAC name is (4aR,11R,11aR,12S,12aR)-3-[2-(1-ethylcyclohexyl)acetyl]-4,4a,6,7,12-pentahydroxy-11-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione.
| Compound Name | (4aR,11R,11aR,12S,12aR)-3-[2-(1-ethylcyclohexyl)acetyl]-4,4a,6,7,12-pentahydroxy-11-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
|---|---|
| PubChem CID | 153105385 |
| Molecular Formula | C29H34O8 |
| Molecular Weight | 510.58 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | (4aR,11R,11aR,12S,12aR)-3-[2-(1-ethylcyclohexyl)acetyl]-4,4a,6,7,12-pentahydroxy-11-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
| SMILES | CCC1(CC(=O)C2=C(O)[C@@]3(O)C(=O)C4=C(O)c5c(O)cccc5[C@H](C)[C@H]4[C@H](O)[C@H]3CC2=O)CCCCC1 |
| InChI | InChI=1S/C29H34O8/c1-3-28(10-5-4-6-11-28)13-19(32)22-18(31)12-16-24(33)20-14(2)15-8-7-9-17(30)21(15)25(34)23(20)27(36)29(16,37)26(22)35/h7-9,14,16,20,24,30,33-35,37H,3-6,10-13H2,1-2H3/t14-,16+,20+,24+,29+/m0/s1 |
| InChIKey | LFVABNUGJFTJJP-PKEAYADNSA-N |
| XLogP | 3.79 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.58 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|