C25H24O8 — CID 58648171
(4aR,11R,11aR,12S,12aR)-3-acetyl-4,4a,6,7-tetrahydroxy-11-methyl-12-(2-oxobut-3-enyl)-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione (PubChem CID 58648171) has the molecular formula C25H24O8 and a molecular weight of 452.46 g/mol. Its IUPAC name is (4aR,11R,11aR,12S,12aR)-3-acetyl-4,4a,6,7-tetrahydroxy-11-methyl-12-(2-oxobut-3-enyl)-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione.
| Compound Name | (4aR,11R,11aR,12S,12aR)-3-acetyl-4,4a,6,7-tetrahydroxy-11-methyl-12-(2-oxobut-3-enyl)-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
|---|---|
| PubChem CID | 58648171 |
| Molecular Formula | C25H24O8 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | (4aR,11R,11aR,12S,12aR)-3-acetyl-4,4a,6,7-tetrahydroxy-11-methyl-12-(2-oxobut-3-enyl)-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
| SMILES | C=CC(=O)C[C@H]1[C@H]2C(=C(O)c3c(O)cccc3[C@@H]2C)C(=O)[C@]2(O)C(O)=C(C(C)=O)C(=O)C[C@H]12 |
| InChI | InChI=1S/C25H24O8/c1-4-12(27)8-14-15-9-17(29)19(11(3)26)23(31)25(15,33)24(32)21-18(14)10(2)13-6-5-7-16(28)20(13)22(21)30/h4-7,10,14-15,18,28,30-31,33H,1,8-9H2,2-3H3/t10-,14+,15+,18-,25+/m0/s1 |
| InChIKey | DNWRMXALCQYTSE-CXYZIXGKSA-N |
| XLogP | 2.46 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|