C22H20O8 — CID 118015046
3-acetyl-4,4a,6,7,12-pentahydroxy-10-methyl-11-methylidene-1,11a,12,12a-tetrahydrotetracene-2,5-dione (PubChem CID 118015046) has the molecular formula C22H20O8 and a molecular weight of 412.39 g/mol. Its IUPAC name is 3-acetyl-4,4a,6,7,12-pentahydroxy-10-methyl-11-methylidene-1,11a,12,12a-tetrahydrotetracene-2,5-dione.
| Compound Name | 3-acetyl-4,4a,6,7,12-pentahydroxy-10-methyl-11-methylidene-1,11a,12,12a-tetrahydrotetracene-2,5-dione |
|---|---|
| PubChem CID | 118015046 |
| Molecular Formula | C22H20O8 |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 3-acetyl-4,4a,6,7,12-pentahydroxy-10-methyl-11-methylidene-1,11a,12,12a-tetrahydrotetracene-2,5-dione |
| SMILES | C=C1c2c(C)ccc(O)c2C(O)=C2C(=O)C3(O)C(O)=C(C(C)=O)C(=O)CC3C(O)C12 |
| InChI | InChI=1S/C22H20O8/c1-7-4-5-11(24)16-13(7)8(2)14-17(19(16)27)21(29)22(30)10(18(14)26)6-12(25)15(9(3)23)20(22)28/h4-5,10,14,18,24,26-28,30H,2,6H2,1,3H3 |
| InChIKey | CUMOUSIHUINFIA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|