C24H23NO9 — CID 54698418
(2-carbamoyl-1,10,11,12a-tetrahydroxy-9-methyl-6-methylidene-3,12-dioxo-4,4a,5,5a-tetrahydrotetracen-5-yl) propanoate (PubChem CID 54698418) has the molecular formula C24H23NO9 and a molecular weight of 469.45 g/mol. Its IUPAC name is (2-carbamoyl-1,10,11,12a-tetrahydroxy-9-methyl-6-methylidene-3,12-dioxo-4,4a,5,5a-tetrahydrotetracen-5-yl) propanoate.
| Compound Name | (2-carbamoyl-1,10,11,12a-tetrahydroxy-9-methyl-6-methylidene-3,12-dioxo-4,4a,5,5a-tetrahydrotetracen-5-yl) propanoate |
|---|---|
| PubChem CID | 54698418 |
| Molecular Formula | C24H23NO9 |
| Molecular Weight | 469.45 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | (2-carbamoyl-1,10,11,12a-tetrahydroxy-9-methyl-6-methylidene-3,12-dioxo-4,4a,5,5a-tetrahydrotetracen-5-yl) propanoate |
| SMILES | C=C1c2ccc(C)c(O)c2C(O)=C2C(=O)C3(O)C(O)=C(C(N)=O)C(=O)CC3C(OC(=O)CC)C12 |
| InChI | InChI=1S/C24H23NO9/c1-4-13(27)34-20-11-7-12(26)16(23(25)32)21(30)24(11,33)22(31)17-14(20)9(3)10-6-5-8(2)18(28)15(10)19(17)29/h5-6,11,14,20,28-30,33H,3-4,7H2,1-2H3,(H2,25,32) |
| InChIKey | GCACPSIJYBYXIT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 184.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.45 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|