C27H29N3O10 — CID 58647512
[(4aR,5S,5aR,12aR)-2-carbamoyl-9-[[2-(dimethylamino)acetyl]amino]-1,10,11,12a-tetrahydroxy-6-methylidene-3,12-dioxo-4,4a,5,5a-tetrahydrotetracen-5-yl] propanoate (PubChem CID 58647512) has the molecular formula C27H29N3O10 and a molecular weight of 555.54 g/mol. Its IUPAC name is [(4aR,5S,5aR,12aR)-2-carbamoyl-9-[[2-(dimethylamino)acetyl]amino]-1,10,11,12a-tetrahydroxy-6-methylidene-3,12-dioxo-4,4a,5,5a-tetrahydrotetracen-5-yl] propanoate.
| Compound Name | [(4aR,5S,5aR,12aR)-2-carbamoyl-9-[[2-(dimethylamino)acetyl]amino]-1,10,11,12a-tetrahydroxy-6-methylidene-3,12-dioxo-4,4a,5,5a-tetrahydrotetracen-5-yl] propanoate |
|---|---|
| PubChem CID | 58647512 |
| Molecular Formula | C27H29N3O10 |
| Molecular Weight | 555.54 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | [(4aR,5S,5aR,12aR)-2-carbamoyl-9-[[2-(dimethylamino)acetyl]amino]-1,10,11,12a-tetrahydroxy-6-methylidene-3,12-dioxo-4,4a,5,5a-tetrahydrotetracen-5-yl] propanoate |
| SMILES | C=C1c2ccc(NC(=O)CN(C)C)c(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C[C@@H]3[C@@H](OC(=O)CC)[C@H]12 |
| InChI | InChI=1S/C27H29N3O10/c1-5-16(33)40-23-12-8-14(31)19(26(28)38)24(36)27(12,39)25(37)20-17(23)10(2)11-6-7-13(21(34)18(11)22(20)35)29-15(32)9-30(3)4/h6-7,12,17,23,34-36,39H,2,5,8-9H2,1,3-4H3,(H2,28,38)(H,29,32)/t12-,17-,23-,27-/m1/s1 |
| InChIKey | VFOYWRCNCGPWDU-RYKNSZQRSA-N |
| XLogP | 0.33 |
| TPSA | 216.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.54 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|