C24H28N4O8 — CID 70193371
(4S,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[[2-(methylamino)acetyl]amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 70193371) has the molecular formula C24H28N4O8 and a molecular weight of 500.51 g/mol. Its IUPAC name is (4S,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[[2-(methylamino)acetyl]amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[[2-(methylamino)acetyl]amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 70193371 |
| Molecular Formula | C24H28N4O8 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | (4S,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[[2-(methylamino)acetyl]amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CNCC(=O)Nc1ccc2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)C3CC1C2 |
| InChI | InChI=1S/C24H28N4O8/c1-26-8-13(29)27-12-5-4-9-6-10-7-11-17(28(2)3)20(32)16(23(25)35)22(34)24(11,36)21(33)15(10)19(31)14(9)18(12)30/h4-5,10-11,17,26,30-31,34,36H,6-8H2,1-3H3,(H2,25,35)(H,27,29)/t10?,11?,17-,24-/m0/s1 |
| InChIKey | GQHLEFSXHGCTCD-NENHCBAQSA-N |
| XLogP | -0.88 |
| TPSA | 202.52 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|