C27H32N4O8 — CID 67844854
N-[(7S)-9-carbamoyl-7-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-2-methylpyrrolidine-1-carboxamide (PubChem CID 67844854) has the molecular formula C27H32N4O8 and a molecular weight of 540.57 g/mol. Its IUPAC name is N-[(7S)-9-carbamoyl-7-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-2-methylpyrrolidine-1-carboxamide.
| Compound Name | N-[(7S)-9-carbamoyl-7-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-2-methylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 67844854 |
| Molecular Formula | C27H32N4O8 |
| Molecular Weight | 540.57 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | N-[(7S)-9-carbamoyl-7-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-2-methylpyrrolidine-1-carboxamide |
| SMILES | CC1CCCN1C(=O)Nc1ccc2c(c1O)C(O)=C1C(=O)C3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)C3CC1C2 |
| InChI | InChI=1S/C27H32N4O8/c1-11-5-4-8-31(11)26(38)29-15-7-6-12-9-13-10-14-19(30(2)3)22(34)18(25(28)37)24(36)27(14,39)23(35)17(13)21(33)16(12)20(15)32/h6-7,11,13-14,19,32-33,36,39H,4-5,8-10H2,1-3H3,(H2,28,37)(H,29,38)/t11?,13?,14?,19-,27?/m0/s1 |
| InChIKey | FYXKUVFPAJJWAZ-VMFRYICQSA-N |
| XLogP | 0.98 |
| TPSA | 193.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.57 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|