C29H28BrN3O9 — CID 70193221
(4S,12aR)-9-[[2-bromo-2-(4-hydroxyphenyl)acetyl]amino]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 70193221) has the molecular formula C29H28BrN3O9 and a molecular weight of 642.46 g/mol. Its IUPAC name is (4S,12aR)-9-[[2-bromo-2-(4-hydroxyphenyl)acetyl]amino]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,12aR)-9-[[2-bromo-2-(4-hydroxyphenyl)acetyl]amino]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 70193221 |
| Molecular Formula | C29H28BrN3O9 |
| Molecular Weight | 642.46 g/mol |
| Exact Mass | 641.10 |
| IUPAC Name | (4S,12aR)-9-[[2-bromo-2-(4-hydroxyphenyl)acetyl]amino]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(ccc(NC(=O)C(Br)c5ccc(O)cc5)c4O)CC3CC12 |
| InChI | InChI=1S/C29H28BrN3O9/c1-33(2)21-15-10-13-9-12-5-8-16(32-28(41)20(30)11-3-6-14(34)7-4-11)22(35)17(12)23(36)18(13)25(38)29(15,42)26(39)19(24(21)37)27(31)40/h3-8,13,15,20-21,34-36,39,42H,9-10H2,1-2H3,(H2,31,40)(H,32,41)/t13?,15?,20?,21-,29-/m0/s1 |
| InChIKey | YMRJAELJGLQAON-NNTVMHTCSA-N |
| XLogP | 1.74 |
| TPSA | 210.72 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.46 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|