C28H36N4O7 — CID 137475292
(4R,4aR,5aS,12aS)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[methyl-(1-methylpiperidin-4-yl)amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 137475292) has the molecular formula C28H36N4O7 and a molecular weight of 540.62 g/mol. Its IUPAC name is (4R,4aR,5aS,12aS)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[methyl-(1-methylpiperidin-4-yl)amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aS)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[methyl-(1-methylpiperidin-4-yl)amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 137475292 |
| Molecular Formula | C28H36N4O7 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | (4R,4aR,5aS,12aS)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[methyl-(1-methylpiperidin-4-yl)amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN1CCC(N(C)c2ccc3c(c2O)C(O)=C2C(=O)[C@@]4(O)C(O)=C(C(N)=O)C(=O)[C@H](N(C)C)[C@H]4C[C@H]2C3)CC1 |
| InChI | InChI=1S/C28H36N4O7/c1-30(2)21-16-12-14-11-13-5-6-17(32(4)15-7-9-31(3)10-8-15)22(33)18(13)23(34)19(14)25(36)28(16,39)26(37)20(24(21)35)27(29)38/h5-6,14-16,21,33-34,37,39H,7-12H2,1-4H3,(H2,29,38)/t14-,16-,21-,28-/m1/s1 |
| InChIKey | ZPRMVZIMFJLNNG-FMALEUAZSA-N |
| XLogP | 0.49 |
| TPSA | 167.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|