C27H23NO8 — CID 58647819
(6Z)-1,5,10,11,12a-pentahydroxy-6-[(4-methylphenyl)methylidene]-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide (PubChem CID 58647819) has the molecular formula C27H23NO8 and a molecular weight of 489.48 g/mol. Its IUPAC name is (6Z)-1,5,10,11,12a-pentahydroxy-6-[(4-methylphenyl)methylidene]-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide.
| Compound Name | (6Z)-1,5,10,11,12a-pentahydroxy-6-[(4-methylphenyl)methylidene]-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 58647819 |
| Molecular Formula | C27H23NO8 |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | (6Z)-1,5,10,11,12a-pentahydroxy-6-[(4-methylphenyl)methylidene]-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
| SMILES | Cc1ccc(/C=C2\c3cccc(O)c3C(O)=C3C(=O)C4(O)C(O)=C(C(N)=O)C(=O)CC4C(O)C32)cc1 |
| InChI | InChI=1S/C27H23NO8/c1-11-5-7-12(8-6-11)9-14-13-3-2-4-16(29)18(13)23(32)21-19(14)22(31)15-10-17(30)20(26(28)35)24(33)27(15,36)25(21)34/h2-9,15,19,22,29,31-33,36H,10H2,1H3,(H2,28,35)/b14-9+ |
| InChIKey | YVKWSAIZNBDGSQ-NTEUORMPSA-N |
| XLogP | 1.70 |
| TPSA | 178.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|