C29H27NO8 — CID 140505587
(4aR,5S,5aR,6Z,12aR)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-6-[(4-propylphenyl)methylidene]-4,4a,5,5a-tetrahydrotetracene-2-carboxamide (PubChem CID 140505587) has the molecular formula C29H27NO8 and a molecular weight of 517.53 g/mol. Its IUPAC name is (4aR,5S,5aR,6Z,12aR)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-6-[(4-propylphenyl)methylidene]-4,4a,5,5a-tetrahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,6Z,12aR)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-6-[(4-propylphenyl)methylidene]-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 140505587 |
| Molecular Formula | C29H27NO8 |
| Molecular Weight | 517.53 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | (4aR,5S,5aR,6Z,12aR)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-6-[(4-propylphenyl)methylidene]-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
| SMILES | CCCc1ccc(/C=C2\c3cccc(O)c3C(O)=C3C(=O)[C@]4(O)C(O)=C(C(N)=O)C(=O)C[C@@H]4[C@@H](O)[C@@H]32)cc1 |
| InChI | InChI=1S/C29H27NO8/c1-2-4-13-7-9-14(10-8-13)11-16-15-5-3-6-18(31)20(15)25(34)23-21(16)24(33)17-12-19(32)22(28(30)37)26(35)29(17,38)27(23)36/h3,5-11,17,21,24,31,33-35,38H,2,4,12H2,1H3,(H2,30,37)/b16-11+/t17-,21-,24-,29-/m1/s1 |
| InChIKey | VHFASXDSDQSFLQ-OJBNJJAZSA-N |
| XLogP | 2.35 |
| TPSA | 178.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|