C28H21NO8 — CID 58648124
(4aR,5S,5aR,6Z,12aR)-6-[(4-ethynylphenyl)methylidene]-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide (PubChem CID 58648124) has the molecular formula C28H21NO8 and a molecular weight of 499.48 g/mol. Its IUPAC name is (4aR,5S,5aR,6Z,12aR)-6-[(4-ethynylphenyl)methylidene]-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,6Z,12aR)-6-[(4-ethynylphenyl)methylidene]-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 58648124 |
| Molecular Formula | C28H21NO8 |
| Molecular Weight | 499.48 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | (4aR,5S,5aR,6Z,12aR)-6-[(4-ethynylphenyl)methylidene]-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
| SMILES | C#Cc1ccc(/C=C2\c3cccc(O)c3C(O)=C3C(=O)[C@]4(O)C(O)=C(C(N)=O)C(=O)C[C@@H]4[C@@H](O)[C@@H]32)cc1 |
| InChI | InChI=1S/C28H21NO8/c1-2-12-6-8-13(9-7-12)10-15-14-4-3-5-17(30)19(14)24(33)22-20(15)23(32)16-11-18(31)21(27(29)36)25(34)28(16,37)26(22)35/h1,3-10,16,20,23,30,32-34,37H,11H2,(H2,29,36)/b15-10+/t16-,20-,23-,28-/m1/s1 |
| InChIKey | PLHNXEPYJWSMDW-QESDZJSRSA-N |
| XLogP | 1.37 |
| TPSA | 178.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.48 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|