C29H25N3O8 — CID 54708382
(4S,4aR,5S,5aR,6Z,12aR)-6-[(4-cyanophenyl)methylidene]-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide (PubChem CID 54708382) has the molecular formula C29H25N3O8 and a molecular weight of 543.53 g/mol. Its IUPAC name is (4S,4aR,5S,5aR,6Z,12aR)-6-[(4-cyanophenyl)methylidene]-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aR,5S,5aR,6Z,12aR)-6-[(4-cyanophenyl)methylidene]-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 54708382 |
| Molecular Formula | C29H25N3O8 |
| Molecular Weight | 543.53 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | (4S,4aR,5S,5aR,6Z,12aR)-6-[(4-cyanophenyl)methylidene]-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cccc4/C(=C\c4ccc(C#N)cc4)[C@H]3[C@H](O)[C@@H]12 |
| InChI | InChI=1S/C29H25N3O8/c1-32(2)22-21-24(35)18-15(10-12-6-8-13(11-30)9-7-12)14-4-3-5-16(33)17(14)23(34)19(18)26(37)29(21,40)27(38)20(25(22)36)28(31)39/h3-10,18,21-22,24,33-35,38,40H,1-2H3,(H2,31,39)/b15-10+/t18-,21-,22+,24+,29+/m1/s1 |
| InChIKey | CUQRINVUUYTHCS-XHHBXOJESA-N |
| XLogP | 0.80 |
| TPSA | 205.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.53 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|