C28H25ClN2O8 — CID 54690775
(6Z)-6-[(4-chlorophenyl)methylidene]-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide (PubChem CID 54690775) has the molecular formula C28H25ClN2O8 and a molecular weight of 552.97 g/mol. Its IUPAC name is (6Z)-6-[(4-chlorophenyl)methylidene]-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide.
| Compound Name | (6Z)-6-[(4-chlorophenyl)methylidene]-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 54690775 |
| Molecular Formula | C28H25ClN2O8 |
| Molecular Weight | 552.97 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | (6Z)-6-[(4-chlorophenyl)methylidene]-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
| SMILES | CN(C)C1C(=O)C(C(N)=O)=C(O)C2(O)C(=O)C3=C(O)c4c(O)cccc4/C(=C\c4ccc(Cl)cc4)C3C(O)C12 |
| InChI | InChI=1S/C28H25ClN2O8/c1-31(2)21-20-23(34)17-14(10-11-6-8-12(29)9-7-11)13-4-3-5-15(32)16(13)22(33)18(17)25(36)28(20,39)26(37)19(24(21)35)27(30)38/h3-10,17,20-21,23,32-34,37,39H,1-2H3,(H2,30,38)/b14-10+ |
| InChIKey | NTIHDXKGSWNQGH-GXDHUFHOSA-N |
| XLogP | 1.59 |
| TPSA | 181.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.97 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|