C25H23NO8 — CID 134184781
(3R,8R,9S,13S,21R)-11-cyclobutyl-3,4,18,20-tetrahydroxy-2,6-dioxo-10-oxapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(20),4,11,14(19),15,17-hexaene-5-carboxamide (PubChem CID 134184781) has the molecular formula C25H23NO8 and a molecular weight of 465.46 g/mol. Its IUPAC name is (3R,8R,9S,13S,21R)-11-cyclobutyl-3,4,18,20-tetrahydroxy-2,6-dioxo-10-oxapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(20),4,11,14(19),15,17-hexaene-5-carboxamide.
| Compound Name | (3R,8R,9S,13S,21R)-11-cyclobutyl-3,4,18,20-tetrahydroxy-2,6-dioxo-10-oxapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(20),4,11,14(19),15,17-hexaene-5-carboxamide |
|---|---|
| PubChem CID | 134184781 |
| Molecular Formula | C25H23NO8 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | (3R,8R,9S,13S,21R)-11-cyclobutyl-3,4,18,20-tetrahydroxy-2,6-dioxo-10-oxapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(20),4,11,14(19),15,17-hexaene-5-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cccc4[C@@H]4C=C(C5CCC5)O[C@@H]([C@@H]34)[C@H]2CC1=O |
| InChI | InChI=1S/C25H23NO8/c26-24(32)18-14(28)8-12-21-17-11(7-15(34-21)9-3-1-4-9)10-5-2-6-13(27)16(10)20(29)19(17)23(31)25(12,33)22(18)30/h2,5-7,9,11-12,17,21,27,29-30,33H,1,3-4,8H2,(H2,26,32)/t11-,12+,17+,21+,25+/m0/s1 |
| InChIKey | YAJZLXYYICGRTI-NLMQMOKKSA-N |
| XLogP | 1.66 |
| TPSA | 167.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|