C29H32N2O8 — CID 137476073
(3S,7R,8S,9R,13S,21S)-11-cyclohexyl-7-(dimethylamino)-3,4,18,20-tetrahydroxy-2,6-dioxo-10-oxapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(20),4,11,14(19),15,17-hexaene-5-carboxamide (PubChem CID 137476073) has the molecular formula C29H32N2O8 and a molecular weight of 536.58 g/mol. Its IUPAC name is (3S,7R,8S,9R,13S,21S)-11-cyclohexyl-7-(dimethylamino)-3,4,18,20-tetrahydroxy-2,6-dioxo-10-oxapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(20),4,11,14(19),15,17-hexaene-5-carboxamide.
| Compound Name | (3S,7R,8S,9R,13S,21S)-11-cyclohexyl-7-(dimethylamino)-3,4,18,20-tetrahydroxy-2,6-dioxo-10-oxapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(20),4,11,14(19),15,17-hexaene-5-carboxamide |
|---|---|
| PubChem CID | 137476073 |
| Molecular Formula | C29H32N2O8 |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | (3S,7R,8S,9R,13S,21S)-11-cyclohexyl-7-(dimethylamino)-3,4,18,20-tetrahydroxy-2,6-dioxo-10-oxapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(20),4,11,14(19),15,17-hexaene-5-carboxamide |
| SMILES | CN(C)[C@H]1C(=O)C(C(N)=O)=C(O)[C@]2(O)C(=O)C3=C(O)c4c(O)cccc4[C@@H]4C=C(C5CCCCC5)O[C@H]([C@H]34)[C@H]12 |
| InChI | InChI=1S/C29H32N2O8/c1-31(2)22-21-25-18-14(11-16(39-25)12-7-4-3-5-8-12)13-9-6-10-15(32)17(13)23(33)19(18)26(35)29(21,38)27(36)20(24(22)34)28(30)37/h6,9-12,14,18,21-22,25,32-33,36,38H,3-5,7-8H2,1-2H3,(H2,30,37)/t14-,18-,21-,22+,25+,29+/m0/s1 |
| InChIKey | TXAYMCTUWUYJNO-QVHREYHZSA-N |
| XLogP | 1.98 |
| TPSA | 170.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|