C27H28N2O8 — CID 137475907
(3R,7R,8R,9S,13S,21R)-11-cyclobutyl-7-(dimethylamino)-3,4,18,20-tetrahydroxy-2,6-dioxo-10-oxapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(20),4,11,14(19),15,17-hexaene-5-carboxamide (PubChem CID 137475907) has the molecular formula C27H28N2O8 and a molecular weight of 508.53 g/mol. Its IUPAC name is (3R,7R,8R,9S,13S,21R)-11-cyclobutyl-7-(dimethylamino)-3,4,18,20-tetrahydroxy-2,6-dioxo-10-oxapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(20),4,11,14(19),15,17-hexaene-5-carboxamide.
| Compound Name | (3R,7R,8R,9S,13S,21R)-11-cyclobutyl-7-(dimethylamino)-3,4,18,20-tetrahydroxy-2,6-dioxo-10-oxapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(20),4,11,14(19),15,17-hexaene-5-carboxamide |
|---|---|
| PubChem CID | 137475907 |
| Molecular Formula | C27H28N2O8 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | (3R,7R,8R,9S,13S,21R)-11-cyclobutyl-7-(dimethylamino)-3,4,18,20-tetrahydroxy-2,6-dioxo-10-oxapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(20),4,11,14(19),15,17-hexaene-5-carboxamide |
| SMILES | CN(C)[C@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cccc4[C@@H]4C=C(C5CCC5)O[C@@H]([C@@H]34)[C@@H]12 |
| InChI | InChI=1S/C27H28N2O8/c1-29(2)20-19-23-16-12(9-14(37-23)10-5-3-6-10)11-7-4-8-13(30)15(11)21(31)17(16)24(33)27(19,36)25(34)18(22(20)32)26(28)35/h4,7-10,12,16,19-20,23,30-31,34,36H,3,5-6H2,1-2H3,(H2,28,35)/t12-,16+,19+,20+,23-,27-/m0/s1 |
| InChIKey | DSZYFZAVQMFFTC-LRKXYGQQSA-N |
| XLogP | 1.20 |
| TPSA | 170.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|