C37H46O9 — CID 23580000
[2-(3-cyclohexylpropanoyl)-6-(2-cyclopentylethyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate (PubChem CID 23580000) has the molecular formula C37H46O9 and a molecular weight of 634.77 g/mol. Its IUPAC name is [2-(3-cyclohexylpropanoyl)-6-(2-cyclopentylethyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate.
| Compound Name | [2-(3-cyclohexylpropanoyl)-6-(2-cyclopentylethyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate |
|---|---|
| PubChem CID | 23580000 |
| Molecular Formula | C37H46O9 |
| Molecular Weight | 634.77 g/mol |
| Exact Mass | 634.31 |
| IUPAC Name | [2-(3-cyclohexylpropanoyl)-6-(2-cyclopentylethyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate |
| SMILES | CCC(=O)OC1C2C(=C(O)c3c(O)cccc3C2CCC2CCCC2)C(=O)C2(O)C(O)=C(C(=O)CCC3CCCCC3)C(=O)CC12 |
| InChI | InChI=1S/C37H46O9/c1-2-28(41)46-34-24-19-27(40)31(26(39)18-16-21-9-4-3-5-10-21)35(43)37(24,45)36(44)32-30(34)23(17-15-20-11-6-7-12-20)22-13-8-14-25(38)29(22)33(32)42/h8,13-14,20-21,23-24,30,34,38,42-43,45H,2-7,9-12,15-19H2,1H3 |
| InChIKey | JXDUIUNGWGZYFX-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.77 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|