C26H31NO9S — CID 71016668
[(4S,6R,12aR)-2-carbamoyl-4-ethyl-3,10,11,12a-tetrahydroxy-6-(methylsulfanylmethyl)-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracen-5-yl] propanoate (PubChem CID 71016668) has the molecular formula C26H31NO9S and a molecular weight of 533.60 g/mol. Its IUPAC name is [(4S,6R,12aR)-2-carbamoyl-4-ethyl-3,10,11,12a-tetrahydroxy-6-(methylsulfanylmethyl)-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracen-5-yl] propanoate.
| Compound Name | [(4S,6R,12aR)-2-carbamoyl-4-ethyl-3,10,11,12a-tetrahydroxy-6-(methylsulfanylmethyl)-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracen-5-yl] propanoate |
|---|---|
| PubChem CID | 71016668 |
| Molecular Formula | C26H31NO9S |
| Molecular Weight | 533.60 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | [(4S,6R,12aR)-2-carbamoyl-4-ethyl-3,10,11,12a-tetrahydroxy-6-(methylsulfanylmethyl)-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracen-5-yl] propanoate |
| SMILES | CCC(=O)OC1C2C(=C(O)c3c(O)cccc3[C@@H]2CSC)C(=O)[C@]2(O)C(=O)C(C(N)=O)C(O)C(CC)C12 |
| InChI | InChI=1S/C26H31NO9S/c1-4-10-19-22(36-14(29)5-2)16-12(9-37-3)11-7-6-8-13(28)15(11)21(31)17(16)23(32)26(19,35)24(33)18(20(10)30)25(27)34/h6-8,10,12,16,18-20,22,28,30-31,35H,4-5,9H2,1-3H3,(H2,27,34)/t10?,12-,16?,18?,19?,20?,22?,26-/m0/s1 |
| InChIKey | UOZFLXKTXPLPDB-IVLZZNIUSA-N |
| XLogP | 1.06 |
| TPSA | 184.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.60 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|