C28H34N2O9 — CID 59984304
[(4R,4aS,5R,5aS,6S,12aS)-2-carbamoyl-4-(dimethylamino)-3,10,11,12a-tetrahydroxy-6-methyl-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracen-5-yl] cyclopentanecarboxylate (PubChem CID 59984304) has the molecular formula C28H34N2O9 and a molecular weight of 542.59 g/mol. Its IUPAC name is [(4R,4aS,5R,5aS,6S,12aS)-2-carbamoyl-4-(dimethylamino)-3,10,11,12a-tetrahydroxy-6-methyl-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracen-5-yl] cyclopentanecarboxylate.
| Compound Name | [(4R,4aS,5R,5aS,6S,12aS)-2-carbamoyl-4-(dimethylamino)-3,10,11,12a-tetrahydroxy-6-methyl-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracen-5-yl] cyclopentanecarboxylate |
|---|---|
| PubChem CID | 59984304 |
| Molecular Formula | C28H34N2O9 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | [(4R,4aS,5R,5aS,6S,12aS)-2-carbamoyl-4-(dimethylamino)-3,10,11,12a-tetrahydroxy-6-methyl-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracen-5-yl] cyclopentanecarboxylate |
| SMILES | C[C@@H]1c2cccc(O)c2C(O)=C2C(=O)[C@@]3(O)C(=O)C(C(N)=O)C(O)[C@H](N(C)C)[C@H]3[C@H](OC(=O)C3CCCC3)[C@H]21 |
| InChI | InChI=1S/C28H34N2O9/c1-11-13-9-6-10-14(31)16(13)21(32)17-15(11)23(39-27(37)12-7-4-5-8-12)19-20(30(2)3)22(33)18(26(29)36)25(35)28(19,38)24(17)34/h6,9-12,15,18-20,22-23,31-33,38H,4-5,7-8H2,1-3H3,(H2,29,36)/t11-,15+,18?,19+,20-,22?,23-,28-/m1/s1 |
| InChIKey | WBRFGBOECNEMCO-RWDGGPCUSA-N |
| XLogP | 0.40 |
| TPSA | 187.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|