C30H30N2O8S — CID 126547703
(4S,4aR,5S,5aR,6R,12aR)-9-(1-benzothiophen-2-yl)-4-(dimethylamino)-3,5,10,11,12a-pentahydroxy-6-methyl-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 126547703) has the molecular formula C30H30N2O8S and a molecular weight of 578.64 g/mol. Its IUPAC name is (4S,4aR,5S,5aR,6R,12aR)-9-(1-benzothiophen-2-yl)-4-(dimethylamino)-3,5,10,11,12a-pentahydroxy-6-methyl-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (4S,4aR,5S,5aR,6R,12aR)-9-(1-benzothiophen-2-yl)-4-(dimethylamino)-3,5,10,11,12a-pentahydroxy-6-methyl-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 126547703 |
| Molecular Formula | C30H30N2O8S |
| Molecular Weight | 578.64 g/mol |
| Exact Mass | 578.17 |
| IUPAC Name | (4S,4aR,5S,5aR,6R,12aR)-9-(1-benzothiophen-2-yl)-4-(dimethylamino)-3,5,10,11,12a-pentahydroxy-6-methyl-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | C[C@H]1c2ccc(-c3cc4ccccc4s3)c(O)c2C(O)=C2C(=O)[C@]3(O)C(=O)C(C(N)=O)C(O)[C@@H](N(C)C)[C@@H]3[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C30H30N2O8S/c1-11-13-8-9-14(16-10-12-6-4-5-7-15(12)41-16)23(33)18(13)24(34)19-17(11)25(35)21-22(32(2)3)26(36)20(29(31)39)28(38)30(21,40)27(19)37/h4-11,17,20-22,25-26,33-36,40H,1-3H3,(H2,31,39)/t11-,17+,20?,21+,22-,25-,26?,30-/m0/s1 |
| InChIKey | MZJSQBLIUVFUIN-GPYNRLHSSA-N |
| XLogP | 1.54 |
| TPSA | 181.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.64 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|