C31H30N4O8S — CID 54684375
(4S,5S,6R,12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-9-[(5-phenyl-1,3-thiazol-2-yl)amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54684375) has the molecular formula C31H30N4O8S and a molecular weight of 618.67 g/mol. Its IUPAC name is (4S,5S,6R,12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-9-[(5-phenyl-1,3-thiazol-2-yl)amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,5S,6R,12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-9-[(5-phenyl-1,3-thiazol-2-yl)amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54684375 |
| Molecular Formula | C31H30N4O8S |
| Molecular Weight | 618.67 g/mol |
| Exact Mass | 618.18 |
| IUPAC Name | (4S,5S,6R,12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-9-[(5-phenyl-1,3-thiazol-2-yl)amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | C[C@H]1c2ccc(Nc3ncc(-c4ccccc4)s3)c(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)C3C(O)C21 |
| InChI | InChI=1S/C31H30N4O8S/c1-12-14-9-10-15(34-30-33-11-16(44-30)13-7-5-4-6-8-13)23(36)18(14)24(37)19-17(12)25(38)21-22(35(2)3)26(39)20(29(32)42)28(41)31(21,43)27(19)40/h4-12,17,21-22,25,36-38,41,43H,1-3H3,(H2,32,42)(H,33,34)/t12-,17?,21?,22-,25?,31-/m0/s1 |
| InChIKey | LJCDXGPMSBTXBO-HRBDUFGNSA-N |
| XLogP | 2.36 |
| TPSA | 206.54 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.67 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|