C30H33N3O9 — CID 126547724
[(4S,4aR,5S,5aR,6R,12aR)-2-carbamoyl-4-(dimethylamino)-3,10,11,12a-tetrahydroxy-6-methyl-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracen-5-yl] 2-(4-aminophenyl)acetate (PubChem CID 126547724) has the molecular formula C30H33N3O9 and a molecular weight of 579.61 g/mol. Its IUPAC name is [(4S,4aR,5S,5aR,6R,12aR)-2-carbamoyl-4-(dimethylamino)-3,10,11,12a-tetrahydroxy-6-methyl-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracen-5-yl] 2-(4-aminophenyl)acetate.
| Compound Name | [(4S,4aR,5S,5aR,6R,12aR)-2-carbamoyl-4-(dimethylamino)-3,10,11,12a-tetrahydroxy-6-methyl-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracen-5-yl] 2-(4-aminophenyl)acetate |
|---|---|
| PubChem CID | 126547724 |
| Molecular Formula | C30H33N3O9 |
| Molecular Weight | 579.61 g/mol |
| Exact Mass | 579.22 |
| IUPAC Name | [(4S,4aR,5S,5aR,6R,12aR)-2-carbamoyl-4-(dimethylamino)-3,10,11,12a-tetrahydroxy-6-methyl-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracen-5-yl] 2-(4-aminophenyl)acetate |
| SMILES | C[C@H]1c2cccc(O)c2C(O)=C2C(=O)[C@]3(O)C(=O)C(C(N)=O)C(O)[C@@H](N(C)C)[C@@H]3[C@@H](OC(=O)Cc3ccc(N)cc3)[C@@H]21 |
| InChI | InChI=1S/C30H33N3O9/c1-12-15-5-4-6-16(34)19(15)24(36)20-18(12)26(42-17(35)11-13-7-9-14(31)10-8-13)22-23(33(2)3)25(37)21(29(32)40)28(39)30(22,41)27(20)38/h4-10,12,18,21-23,25-26,34,36-37,41H,11,31H2,1-3H3,(H2,32,40)/t12-,18+,21?,22+,23-,25?,26-,30-/m0/s1 |
| InChIKey | YSGKTIMWPSVOIO-XPPRMPIZSA-N |
| XLogP | 0.04 |
| TPSA | 213.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.61 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|