C28H38N2O8 — CID 126547650
(4S,4aR,5S,5aR,6R,12aR)-4-(dimethylamino)-3,5,10,11,12a-pentahydroxy-6-methyl-9-(2-methylpentan-2-yl)-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 126547650) has the molecular formula C28H38N2O8 and a molecular weight of 530.62 g/mol. Its IUPAC name is (4S,4aR,5S,5aR,6R,12aR)-4-(dimethylamino)-3,5,10,11,12a-pentahydroxy-6-methyl-9-(2-methylpentan-2-yl)-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (4S,4aR,5S,5aR,6R,12aR)-4-(dimethylamino)-3,5,10,11,12a-pentahydroxy-6-methyl-9-(2-methylpentan-2-yl)-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 126547650 |
| Molecular Formula | C28H38N2O8 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | (4S,4aR,5S,5aR,6R,12aR)-4-(dimethylamino)-3,5,10,11,12a-pentahydroxy-6-methyl-9-(2-methylpentan-2-yl)-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | CCCC(C)(C)c1ccc2c(c1O)C(O)=C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(O)[C@@H](N(C)C)[C@@H]3[C@@H](O)[C@@H]1[C@H]2C |
| InChI | InChI=1S/C28H38N2O8/c1-7-10-27(3,4)13-9-8-12-11(2)14-16(21(32)15(12)20(13)31)24(35)28(38)18(22(14)33)19(30(5)6)23(34)17(25(28)36)26(29)37/h8-9,11,14,17-19,22-23,31-34,38H,7,10H2,1-6H3,(H2,29,37)/t11-,14+,17?,18+,19-,22-,23?,28-/m0/s1 |
| InChIKey | QQVNXEZACZQMMW-ZFOPKDQESA-N |
| XLogP | 0.74 |
| TPSA | 181.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|