C28H36N2O9S — CID 69473613
[(4S,4aR,5S,5aR,6R,12aR)-2-[amino(hydroxy)methyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-6-(propylsulfanylmethyl)-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate (PubChem CID 69473613) has the molecular formula C28H36N2O9S and a molecular weight of 576.67 g/mol. Its IUPAC name is [(4S,4aR,5S,5aR,6R,12aR)-2-[amino(hydroxy)methyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-6-(propylsulfanylmethyl)-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate.
| Compound Name | [(4S,4aR,5S,5aR,6R,12aR)-2-[amino(hydroxy)methyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-6-(propylsulfanylmethyl)-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate |
|---|---|
| PubChem CID | 69473613 |
| Molecular Formula | C28H36N2O9S |
| Molecular Weight | 576.67 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | [(4S,4aR,5S,5aR,6R,12aR)-2-[amino(hydroxy)methyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-6-(propylsulfanylmethyl)-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate |
| SMILES | CCCSC[C@H]1c2cccc(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)O)C(=O)[C@@H](N(C)C)[C@@H]3[C@@H](OC(=O)CC)[C@@H]21 |
| InChI | InChI=1S/C28H36N2O9S/c1-5-10-40-11-13-12-8-7-9-14(31)16(12)22(33)18-17(13)24(39-15(32)6-2)20-21(30(3)4)23(34)19(27(29)37)26(36)28(20,38)25(18)35/h7-9,13,17,20-21,24,27,31,33,36-38H,5-6,10-11,29H2,1-4H3/t13-,17+,20+,21-,24-,27?,28-/m0/s1 |
| InChIKey | SRDAFWTYKAPWLI-GERANXPHSA-N |
| XLogP | 1.37 |
| TPSA | 190.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.67 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|