C31H40N2O9S — CID 54686910
[(4S,12aR)-9-tert-butyl-2-carbamoyl-4-(dimethylamino)-6-(ethylsulfanylmethyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate (PubChem CID 54686910) has the molecular formula C31H40N2O9S and a molecular weight of 616.73 g/mol. Its IUPAC name is [(4S,12aR)-9-tert-butyl-2-carbamoyl-4-(dimethylamino)-6-(ethylsulfanylmethyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate.
| Compound Name | [(4S,12aR)-9-tert-butyl-2-carbamoyl-4-(dimethylamino)-6-(ethylsulfanylmethyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate |
|---|---|
| PubChem CID | 54686910 |
| Molecular Formula | C31H40N2O9S |
| Molecular Weight | 616.73 g/mol |
| Exact Mass | 616.25 |
| IUPAC Name | [(4S,12aR)-9-tert-butyl-2-carbamoyl-4-(dimethylamino)-6-(ethylsulfanylmethyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate |
| SMILES | CCSCC1c2ccc(C(C)(C)C)c(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)C3C(OC(=O)CC)C21 |
| InChI | InChI=1S/C31H40N2O9S/c1-8-16(34)42-26-17-14(12-43-9-2)13-10-11-15(30(3,4)5)23(35)18(13)24(36)19(17)27(38)31(41)21(26)22(33(6)7)25(37)20(28(31)39)29(32)40/h10-11,14,17,21-22,26,35-36,39,41H,8-9,12H2,1-7H3,(H2,32,40)/t14?,17?,21?,22-,26?,31-/m0/s1 |
| InChIKey | BSGYPOWLVDAMLD-FLJXJTMHSA-N |
| XLogP | 2.49 |
| TPSA | 187.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.73 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|