C27H33N3O9 — CID 72658136
[2-carbamoyl-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate (PubChem CID 72658136) has the molecular formula C27H33N3O9 and a molecular weight of 543.57 g/mol. Its IUPAC name is [2-carbamoyl-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate.
| Compound Name | [2-carbamoyl-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate |
|---|---|
| PubChem CID | 72658136 |
| Molecular Formula | C27H33N3O9 |
| Molecular Weight | 543.57 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | [2-carbamoyl-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate |
| SMILES | CCC(=O)OC1C2C(=C(O)c3c(O)ccc(N(C)C)c3C2C)C(=O)C2(O)C(O)=C(C(N)=O)C(=O)C(N(C)C)C12 |
| InChI | InChI=1S/C27H33N3O9/c1-7-13(32)39-23-15-10(2)14-11(29(3)4)8-9-12(31)16(14)21(33)17(15)24(35)27(38)19(23)20(30(5)6)22(34)18(25(27)36)26(28)37/h8-10,15,19-20,23,31,33,36,38H,7H2,1-6H3,(H2,28,37) |
| InChIKey | HOIMICFKGYTWTQ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 190.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.57 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|