C31H41N3O9 — CID 58461288
[(4R,4aS,5R,5aS,6S,12aS)-9-tert-butyl-2-carbamoyl-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate (PubChem CID 58461288) has the molecular formula C31H41N3O9 and a molecular weight of 599.68 g/mol. Its IUPAC name is [(4R,4aS,5R,5aS,6S,12aS)-9-tert-butyl-2-carbamoyl-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate.
| Compound Name | [(4R,4aS,5R,5aS,6S,12aS)-9-tert-butyl-2-carbamoyl-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate |
|---|---|
| PubChem CID | 58461288 |
| Molecular Formula | C31H41N3O9 |
| Molecular Weight | 599.68 g/mol |
| Exact Mass | 599.28 |
| IUPAC Name | [(4R,4aS,5R,5aS,6S,12aS)-9-tert-butyl-2-carbamoyl-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate |
| SMILES | CCC(=O)O[C@@H]1[C@@H]2C(=C(O)c3c(O)c(C(C)(C)C)cc(N(C)C)c3[C@H]2C)C(=O)[C@@]2(O)C(O)=C(C(N)=O)C(=O)[C@H](N(C)C)[C@@H]12 |
| InChI | InChI=1S/C31H41N3O9/c1-10-15(35)43-26-17-12(2)16-14(33(6)7)11-13(30(3,4)5)23(36)18(16)24(37)19(17)27(39)31(42)21(26)22(34(8)9)25(38)20(28(31)40)29(32)41/h11-12,17,21-22,26,36-37,40,42H,10H2,1-9H3,(H2,32,41)/t12-,17+,21+,22-,26-,31-/m1/s1 |
| InChIKey | DNFCLPNYALYUKI-RQBWWSTNSA-N |
| XLogP | 1.82 |
| TPSA | 190.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.68 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|