C29H35ClN2O9 — CID 54708842
[(4S,6R,12aR)-2-carbamoyl-9-(3-chloro-2-methylpropyl)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate (PubChem CID 54708842) has the molecular formula C29H35ClN2O9 and a molecular weight of 591.06 g/mol. Its IUPAC name is [(4S,6R,12aR)-2-carbamoyl-9-(3-chloro-2-methylpropyl)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate.
| Compound Name | [(4S,6R,12aR)-2-carbamoyl-9-(3-chloro-2-methylpropyl)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate |
|---|---|
| PubChem CID | 54708842 |
| Molecular Formula | C29H35ClN2O9 |
| Molecular Weight | 591.06 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | [(4S,6R,12aR)-2-carbamoyl-9-(3-chloro-2-methylpropyl)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate |
| SMILES | CCC(=O)OC1C2C(=C(O)c3c(ccc(CC(C)CCl)c3O)[C@@H]2C)C(=O)[C@]2(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)C12 |
| InChI | InChI=1S/C29H35ClN2O9/c1-6-15(33)41-25-16-12(3)14-8-7-13(9-11(2)10-30)22(34)17(14)23(35)18(16)26(37)29(40)20(25)21(32(4)5)24(36)19(27(29)38)28(31)39/h7-8,11-12,16,20-21,25,34-35,38,40H,6,9-10H2,1-5H3,(H2,31,39)/t11?,12-,16?,20?,21-,25?,29-/m0/s1 |
| InChIKey | GMEYZVDOECKMLE-PPBAHCBWSA-N |
| XLogP | 1.87 |
| TPSA | 187.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.06 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|