C26H28N2O10 — CID 59603260
[(4S,4aR,5S,5aR,6R,12aR)-9-acetyl-2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] acetate (PubChem CID 59603260) has the molecular formula C26H28N2O10 and a molecular weight of 528.51 g/mol. Its IUPAC name is [(4S,4aR,5S,5aR,6R,12aR)-9-acetyl-2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] acetate.
| Compound Name | [(4S,4aR,5S,5aR,6R,12aR)-9-acetyl-2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] acetate |
|---|---|
| PubChem CID | 59603260 |
| Molecular Formula | C26H28N2O10 |
| Molecular Weight | 528.51 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | [(4S,4aR,5S,5aR,6R,12aR)-9-acetyl-2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H]2C(=C(O)c3c(ccc(C(C)=O)c3O)[C@@H]2C)C(=O)[C@]2(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@H]12 |
| InChI | InChI=1S/C26H28N2O10/c1-8-11-6-7-12(9(2)29)19(31)14(11)20(32)15-13(8)22(38-10(3)30)17-18(28(4)5)21(33)16(25(27)36)24(35)26(17,37)23(15)34/h6-8,13,17-18,22,31-32,35,37H,1-5H3,(H2,27,36)/t8-,13+,17+,18-,22-,26-/m0/s1 |
| InChIKey | WWHBQGMVTZIXBT-NNUKFXCWSA-N |
| XLogP | 0.27 |
| TPSA | 204.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.51 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|