C27H34N2O8 — CID 54722046
(12aS)-9-tert-butyl-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6,7-dimethyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54722046) has the molecular formula C27H34N2O8 and a molecular weight of 514.58 g/mol. Its IUPAC name is (12aS)-9-tert-butyl-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6,7-dimethyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (12aS)-9-tert-butyl-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6,7-dimethyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54722046 |
| Molecular Formula | C27H34N2O8 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | (12aS)-9-tert-butyl-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6,7-dimethyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | Cc1cc(C(C)(C)C)c(O)c2c1C(C)C1C(=C2O)C(=O)[C@@]2(O)C(O)=C(C(N)=O)C(=O)C(N(C)C)C2C1O |
| InChI | InChI=1S/C27H34N2O8/c1-9-8-11(26(3,4)5)19(30)14-12(9)10(2)13-15(20(14)31)23(34)27(37)17(21(13)32)18(29(6)7)22(33)16(24(27)35)25(28)36/h8,10,13,17-18,21,30-32,35,37H,1-7H3,(H2,28,36)/t10?,13?,17?,18?,21?,27-/m1/s1 |
| InChIKey | XOMWVGPDLMNYTC-WCTKXYRXSA-N |
| XLogP | 1.10 |
| TPSA | 181.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|