C22H22F2N2O8 — CID 118505012
4-(dimethylamino)-7,9-difluoro-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 118505012) has the molecular formula C22H22F2N2O8 and a molecular weight of 480.42 g/mol. Its IUPAC name is 4-(dimethylamino)-7,9-difluoro-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-7,9-difluoro-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 118505012 |
| Molecular Formula | C22H22F2N2O8 |
| Molecular Weight | 480.42 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 4-(dimethylamino)-7,9-difluoro-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC1c2c(F)cc(F)c(O)c2C(O)=C2C(=O)C3(O)C(O)=C(C(N)=O)C(=O)C(N(C)C)C3C(O)C21 |
| InChI | InChI=1S/C22H22F2N2O8/c1-5-8-6(23)4-7(24)15(27)10(8)16(28)11-9(5)17(29)13-14(26(2)3)18(30)12(21(25)33)20(32)22(13,34)19(11)31/h4-5,9,13-14,17,27-29,32,34H,1-3H3,(H2,25,33) |
| InChIKey | UWTWQZNJRDBBNS-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 181.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.42 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|