C23H24FNO8 — CID 67474653
(1S,4aR,11R,11aR,12S,12aR)-3-acetyl-1-(dimethylamino)-10-(18F)fluoro-4,4a,6,7,12-pentahydroxy-11-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione (PubChem CID 67474653) has the molecular formula C23H24FNO8 and a molecular weight of 460.44 g/mol. Its IUPAC name is (1S,4aR,11R,11aR,12S,12aR)-3-acetyl-1-(dimethylamino)-10-(18F)fluoro-4,4a,6,7,12-pentahydroxy-11-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione.
| Compound Name | (1S,4aR,11R,11aR,12S,12aR)-3-acetyl-1-(dimethylamino)-10-(18F)fluoro-4,4a,6,7,12-pentahydroxy-11-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
|---|---|
| PubChem CID | 67474653 |
| Molecular Formula | C23H24FNO8 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | (1S,4aR,11R,11aR,12S,12aR)-3-acetyl-1-(dimethylamino)-10-(18F)fluoro-4,4a,6,7,12-pentahydroxy-11-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
| SMILES | CC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc([18F])c4[C@H](C)[C@H]3[C@H](O)[C@H]2[C@H](N(C)C)C1=O |
| InChI | InChI=1S/C23H24FNO8/c1-7-11-9(24)5-6-10(27)14(11)18(28)15-12(7)19(29)16-17(25(3)4)20(30)13(8(2)26)21(31)23(16,33)22(15)32/h5-7,12,16-17,19,27-29,31,33H,1-4H3/t7-,12+,16+,17-,19-,23+/m0/s1/i24-1 |
| InChIKey | DLYRHOAEYUGRPZ-NWBZTPORSA-N |
| XLogP | 0.74 |
| TPSA | 155.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|