C28H37N3O8 — CID 137475902
(4S,4aS,5S,5aR,6R,12aR)-9-tert-butyl-4,7-bis(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 137475902) has the molecular formula C28H37N3O8 and a molecular weight of 543.62 g/mol. Its IUPAC name is (4S,4aS,5S,5aR,6R,12aR)-9-tert-butyl-4,7-bis(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5S,5aR,6R,12aR)-9-tert-butyl-4,7-bis(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 137475902 |
| Molecular Formula | C28H37N3O8 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | (4S,4aS,5S,5aR,6R,12aR)-9-tert-butyl-4,7-bis(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | C[C@H]1c2c(N(C)C)cc(C(C)(C)C)c(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@H]3[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C28H37N3O8/c1-10-13-12(30(5)6)9-11(27(2,3)4)20(32)15(13)21(33)16-14(10)22(34)18-19(31(7)8)23(35)17(26(29)38)25(37)28(18,39)24(16)36/h9-10,14,18-19,22,32-34,37,39H,1-8H3,(H2,29,38)/t10-,14+,18-,19-,22-,28-/m0/s1 |
| InChIKey | IHDTXMWNRMEVOC-BAXAFXTMSA-N |
| XLogP | 0.86 |
| TPSA | 184.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|