C28H32N2O12 — CID 118504972
3-[[2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-6-(propoxymethyl)-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl]oxy]-3-oxopropanoic acid (PubChem CID 118504972) has the molecular formula C28H32N2O12 and a molecular weight of 588.57 g/mol. Its IUPAC name is 3-[[2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-6-(propoxymethyl)-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl]oxy]-3-oxopropanoic acid.
| Compound Name | 3-[[2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-6-(propoxymethyl)-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl]oxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 118504972 |
| Molecular Formula | C28H32N2O12 |
| Molecular Weight | 588.57 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | 3-[[2-carbamoyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-6-(propoxymethyl)-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl]oxy]-3-oxopropanoic acid |
| SMILES | CCCOCC1c2cccc(O)c2C(O)=C2C(=O)C3(O)C(O)=C(C(N)=O)C(=O)C(N(C)C)C3C(OC(=O)CC(=O)O)C21 |
| InChI | InChI=1S/C28H32N2O12/c1-4-8-41-10-12-11-6-5-7-13(31)16(11)22(35)18-17(12)24(42-15(34)9-14(32)33)20-21(30(2)3)23(36)19(27(29)39)26(38)28(20,40)25(18)37/h5-7,12,17,20-21,24,31,35,38,40H,4,8-10H2,1-3H3,(H2,29,39)(H,32,33) |
| InChIKey | XTWIUBHFCLUSHP-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 234.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.57 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|