C33H41NO9 — CID 58648295
[(4aR,5S,5aR,6R,12aR)-9-tert-butyl-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-2-(3-pyrrolidin-1-ylpropanoyl)-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate (PubChem CID 58648295) has the molecular formula C33H41NO9 and a molecular weight of 595.69 g/mol. Its IUPAC name is [(4aR,5S,5aR,6R,12aR)-9-tert-butyl-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-2-(3-pyrrolidin-1-ylpropanoyl)-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate.
| Compound Name | [(4aR,5S,5aR,6R,12aR)-9-tert-butyl-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-2-(3-pyrrolidin-1-ylpropanoyl)-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate |
|---|---|
| PubChem CID | 58648295 |
| Molecular Formula | C33H41NO9 |
| Molecular Weight | 595.69 g/mol |
| Exact Mass | 595.28 |
| IUPAC Name | [(4aR,5S,5aR,6R,12aR)-9-tert-butyl-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-2-(3-pyrrolidin-1-ylpropanoyl)-4a,5,5a,6-tetrahydro-4H-tetracen-5-yl] propanoate |
| SMILES | CCC(=O)O[C@H]1[C@H]2C(=C(O)c3c(ccc(C(C)(C)C)c3O)[C@@H]2C)C(=O)[C@]2(O)C(O)=C(C(=O)CCN3CCCC3)C(=O)C[C@H]12 |
| InChI | InChI=1S/C33H41NO9/c1-6-22(37)43-29-19-15-21(36)25(20(35)11-14-34-12-7-8-13-34)30(40)33(19,42)31(41)26-23(29)16(2)17-9-10-18(32(3,4)5)27(38)24(17)28(26)39/h9-10,16,19,23,29,38-40,42H,6-8,11-15H2,1-5H3/t16-,19+,23+,29+,33+/m0/s1 |
| InChIKey | CBMGWOGOAULAKV-ACWAZJPMSA-N |
| XLogP | 3.78 |
| TPSA | 161.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.69 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|