C22H23N5O8 — CID 54703920
(4aR,5R,5aR,6R,12aR)-9-azido-7-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54703920) has the molecular formula C22H23N5O8 and a molecular weight of 485.45 g/mol. Its IUPAC name is (4aR,5R,5aR,6R,12aR)-9-azido-7-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aR,5R,5aR,6R,12aR)-9-azido-7-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54703920 |
| Molecular Formula | C22H23N5O8 |
| Molecular Weight | 485.45 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | (4aR,5R,5aR,6R,12aR)-9-azido-7-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | C[C@H]1c2c(N(C)C)cc(N=[N+]=[N-])c(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C[C@@H]3[C@H](O)[C@@H]21 |
| InChI | InChI=1S/C22H23N5O8/c1-6-11-9(27(2)3)5-8(25-26-24)17(30)14(11)18(31)15-12(6)16(29)7-4-10(28)13(21(23)34)19(32)22(7,35)20(15)33/h5-7,12,16,29-32,35H,4H2,1-3H3,(H2,23,34)/t6-,7+,12+,16-,22+/m0/s1 |
| InChIKey | MHZLDSNDDGSZCQ-XXOOOLIESA-N |
| XLogP | 0.96 |
| TPSA | 230.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.45 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|