C21H22N2O8 — CID 59109061
3,5,10,11,12a-pentahydroxy-4-(methylamino)-6-methylidene-1,12-dioxo-2,3,4,4a,5,5a-hexahydrotetracene-2-carboxamide (PubChem CID 59109061) has the molecular formula C21H22N2O8 and a molecular weight of 430.41 g/mol. Its IUPAC name is 3,5,10,11,12a-pentahydroxy-4-(methylamino)-6-methylidene-1,12-dioxo-2,3,4,4a,5,5a-hexahydrotetracene-2-carboxamide.
| Compound Name | 3,5,10,11,12a-pentahydroxy-4-(methylamino)-6-methylidene-1,12-dioxo-2,3,4,4a,5,5a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 59109061 |
| Molecular Formula | C21H22N2O8 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 3,5,10,11,12a-pentahydroxy-4-(methylamino)-6-methylidene-1,12-dioxo-2,3,4,4a,5,5a-hexahydrotetracene-2-carboxamide |
| SMILES | C=C1c2cccc(O)c2C(O)=C2C(=O)C3(O)C(=O)C(C(N)=O)C(O)C(NC)C3C(O)C12 |
| InChI | InChI=1S/C21H22N2O8/c1-6-7-4-3-5-8(24)10(7)15(25)11-9(6)16(26)13-14(23-2)17(27)12(20(22)30)19(29)21(13,31)18(11)28/h3-5,9,12-14,16-17,23-27,31H,1H2,2H3,(H2,22,30) |
| InChIKey | FNBXPNVAVIXEHU-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 190.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|