C21H24N2O9 — CID 59109066
3,5,6,10,11,12a-hexahydroxy-6-methyl-4-(methylamino)-1,12-dioxo-2,3,4,4a,5,5a-hexahydrotetracene-2-carboxamide (PubChem CID 59109066) has the molecular formula C21H24N2O9 and a molecular weight of 448.43 g/mol. Its IUPAC name is 3,5,6,10,11,12a-hexahydroxy-6-methyl-4-(methylamino)-1,12-dioxo-2,3,4,4a,5,5a-hexahydrotetracene-2-carboxamide.
| Compound Name | 3,5,6,10,11,12a-hexahydroxy-6-methyl-4-(methylamino)-1,12-dioxo-2,3,4,4a,5,5a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 59109066 |
| Molecular Formula | C21H24N2O9 |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 3,5,6,10,11,12a-hexahydroxy-6-methyl-4-(methylamino)-1,12-dioxo-2,3,4,4a,5,5a-hexahydrotetracene-2-carboxamide |
| SMILES | CNC1C(O)C(C(N)=O)C(=O)C2(O)C(=O)C3=C(O)c4c(O)cccc4C(C)(O)C3C(O)C12 |
| InChI | InChI=1S/C21H24N2O9/c1-20(31)6-4-3-5-7(24)8(6)14(25)9-11(20)16(27)12-13(23-2)15(26)10(19(22)30)18(29)21(12,32)17(9)28/h3-5,10-13,15-16,23-27,31-32H,1-2H3,(H2,22,30) |
| InChIKey | OSHYQBAXIFYUEC-UHFFFAOYSA-N |
| XLogP | -2.58 |
| TPSA | 210.64 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|