C44H48CaN4O18 — CID 171040264
CID 171040264 (PubChem CID 171040264) has the molecular formula C44H48CaN4O18 and a molecular weight of 960.96 g/mol.
| Compound Name | CID 171040264 |
|---|---|
| PubChem CID | 171040264 |
| Molecular Formula | C44H48CaN4O18 |
| Molecular Weight | 960.96 g/mol |
| Exact Mass | 960.26 |
| IUPAC Name | — |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cccc4[C@@](C)(O)[C@H]3[C@H](O)[C@@H]12.CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cccc4[C@@](C)(O)[C@H]3[C@H](O)[C@@H]12.[Ca] |
| InChI | InChI=1S/2C22H24N2O9.Ca/c2*1-21(32)7-5-4-6-8(25)9(7)15(26)10-12(21)17(28)13-14(24(2)3)16(27)11(20(23)31)19(30)22(13,33)18(10)29;/h2*4-6,12-14,17,25-26,28,30,32-33H,1-3H3,(H2,23,31);/t2*12-,13-,14+,17+,21-,22+;/m11./s1 |
| InChIKey | JFJOVFFGFZZXCA-MXWBXKMOSA-N |
| XLogP | -3.18 |
| TPSA | 403.70 Ų |
| H-Bond Donors | 14 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 960.96 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 14 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|