C22H23N2NaO9 — CID 54686002
sodium 3-carbamoyl-1-(dimethylamino)-4,6,7,11,12-pentahydroxy-11-methyl-2,5-dioxo-1,11a,12,12a-tetrahydrotetracen-4a-olate (PubChem CID 54686002) has the molecular formula C22H23N2NaO9 and a molecular weight of 482.42 g/mol. Its IUPAC name is sodium 3-carbamoyl-1-(dimethylamino)-4,6,7,11,12-pentahydroxy-11-methyl-2,5-dioxo-1,11a,12,12a-tetrahydrotetracen-4a-olate.
| Compound Name | sodium 3-carbamoyl-1-(dimethylamino)-4,6,7,11,12-pentahydroxy-11-methyl-2,5-dioxo-1,11a,12,12a-tetrahydrotetracen-4a-olate |
|---|---|
| PubChem CID | 54686002 |
| Molecular Formula | C22H23N2NaO9 |
| Molecular Weight | 482.42 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | sodium 3-carbamoyl-1-(dimethylamino)-4,6,7,11,12-pentahydroxy-11-methyl-2,5-dioxo-1,11a,12,12a-tetrahydrotetracen-4a-olate |
| SMILES | CN(C)C1C(=O)C(C(N)=O)=C(O)C2([O-])C(=O)C3=C(O)c4c(O)cccc4C(C)(O)C3C(O)C12.[Na+] |
| InChI | InChI=1S/C22H23N2O9.Na/c1-21(32)7-5-4-6-8(25)9(7)15(26)10-12(21)17(28)13-14(24(2)3)16(27)11(20(23)31)19(30)22(13,33)18(10)29;/h4-6,12-14,17,25-26,28,30,32H,1-3H3,(H2,23,31);/q-1;+1 |
| InChIKey | DVISIZHJBMZSPJ-UHFFFAOYSA-N |
| XLogP | -5.03 |
| TPSA | 204.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.42 |
| LogP ≤ 5 | -5.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|